| Name | Solvent Yellow 43 |
| Synonyms | DFSB-K 43 SOLVENT YELLOW 43 Solvent Yellow 116 Solvent Yellow 43 Day-Glo Tigris Yellow Fluorescent Brightener 75 FLUORESCENT BRILLIANT YELLOW R (12226-96-9) solvent yellow 43 4-Butylamino-N-butyl-1,8-naphthalimide 4-(Butylamino)-N-butyl-1,8-naphthalimide N-Butyl-4-(butylamino)-1,8-naphthalenedicarbimide 2-Butyl-6-(butylamino)-1H-benz(de)isoquinoline-1,3(2H)-dione 2-butyl-6-(butylamino)-1H-benzo[de]isoquinoline-1,3(2H)-dione 1H-Benz(de)isoquinoline-1,3(2H)-dione, 2-butyl-6-(butylamino)- |
| CAS | 19125-99-6 |
| EINECS | 242-828-7 |
| InChI | InChI=1/C20H24N2O2/c1-3-5-12-21-17-11-10-16-18-14(17)8-7-9-15(18)19(23)22(20(16)24)13-6-4-2/h7-11,21H,3-6,12-13H2,1-2H3 |
| Molecular Formula | C20H24N2O2 |
| Molar Mass | 324.42 |
| Density | 1.174 |
| Melting Point | 126-127℃ |
| Boling Point | 500.4±33.0 °C(Predicted) |
| Flash Point | 256.4°C |
| Water Solubility | 50.7μg/L at 28℃ |
| Vapor Presure | 3.81E-10mmHg at 25°C |
| pKa | 2.66±0.20(Predicted) |
| Refractive Index | 1.624 |
| Use | For resin, acetate, nylon, nylon, plastic, coating and printing ink coloring |
| LogP | 4.643 at 25℃ |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | for resin, acetate, nylon, nylon, plastic, coloring of coatings and printing inks |